C15H30O6P2 — CID 10339001
[(7E)-8,12-dimethyl-1-phosphonotrideca-7,11-dienyl]phosphonic acid (PubChem CID 10339001) has the molecular formula C15H30O6P2 and a molecular weight of 368.35 g/mol. Its IUPAC name is [(7E)-8,12-dimethyl-1-phosphonotrideca-7,11-dienyl]phosphonic acid.
| Compound Name | [(7E)-8,12-dimethyl-1-phosphonotrideca-7,11-dienyl]phosphonic acid |
|---|---|
| PubChem CID | 10339001 |
| Molecular Formula | C15H30O6P2 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | [(7E)-8,12-dimethyl-1-phosphonotrideca-7,11-dienyl]phosphonic acid |
| SMILES | CC(C)=CCC/C(C)=C/CCCCCC(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C15H30O6P2/c1-13(2)9-8-11-14(3)10-6-4-5-7-12-15(22(16,17)18)23(19,20)21/h9-10,15H,4-8,11-12H2,1-3H3,(H2,16,17,18)(H2,19,20,21)/b14-10+ |
| InChIKey | YCVCYJHGGKYDRH-GXDHUFHOSA-N |
| XLogP | 4.31 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|