C15H30O6P2 — CID 10339002
[(5E)-1-[hydroxy(methoxymethyl)phosphoryl]-6,10-dimethylundeca-5,9-dienyl]phosphonic acid (PubChem CID 10339002) has the molecular formula C15H30O6P2 and a molecular weight of 368.35 g/mol. Its IUPAC name is [(5E)-1-[hydroxy(methoxymethyl)phosphoryl]-6,10-dimethylundeca-5,9-dienyl]phosphonic acid.
| Compound Name | [(5E)-1-[hydroxy(methoxymethyl)phosphoryl]-6,10-dimethylundeca-5,9-dienyl]phosphonic acid |
|---|---|
| PubChem CID | 10339002 |
| Molecular Formula | C15H30O6P2 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | [(5E)-1-[hydroxy(methoxymethyl)phosphoryl]-6,10-dimethylundeca-5,9-dienyl]phosphonic acid |
| SMILES | COCP(=O)(O)C(CCC/C=C(\C)CCC=C(C)C)P(=O)(O)O |
| InChI | InChI=1S/C15H30O6P2/c1-13(2)8-7-10-14(3)9-5-6-11-15(23(18,19)20)22(16,17)12-21-4/h8-9,15H,5-7,10-12H2,1-4H3,(H,16,17)(H2,18,19,20)/b14-9+ |
| InChIKey | CAOYIFBVILXMOX-NTEUORMPSA-N |
| XLogP | 4.23 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|