C19H24N6O2 — CID 10339033
(6S)-N-[(4-carbamimidoylphenyl)methyl]-4-oxo-3-(propylamino)-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carboxamide (PubChem CID 10339033) has the molecular formula C19H24N6O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is (6S)-N-[(4-carbamimidoylphenyl)methyl]-4-oxo-3-(propylamino)-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carboxamide.
| Compound Name | (6S)-N-[(4-carbamimidoylphenyl)methyl]-4-oxo-3-(propylamino)-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 10339033 |
| Molecular Formula | C19H24N6O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | (6S)-N-[(4-carbamimidoylphenyl)methyl]-4-oxo-3-(propylamino)-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@@H]2CCc3ncc(NCCC)c(=O)n32)cc1 |
| InChI | InChI=1S/C19H24N6O2/c1-2-9-22-14-11-23-16-8-7-15(25(16)19(14)27)18(26)24-10-12-3-5-13(6-4-12)17(20)21/h3-6,11,15,22H,2,7-10H2,1H3,(H3,20,21)(H,24,26)/t15-/m0/s1 |
| InChIKey | QVDKIDCMKYACQU-HNNXBMFYSA-N |
| XLogP | 1.15 |
| TPSA | 125.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|