C7H16N2S — CID 103391245
2-N-(thiolan-3-yl)propane-1,2-diamine (PubChem CID 103391245) has the molecular formula C7H16N2S and a molecular weight of 160.29 g/mol. Its IUPAC name is 2-N-(thiolan-3-yl)propane-1,2-diamine.
| Compound Name | 2-N-(thiolan-3-yl)propane-1,2-diamine |
|---|---|
| PubChem CID | 103391245 |
| Molecular Formula | C7H16N2S |
| Molecular Weight | 160.29 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 2-N-(thiolan-3-yl)propane-1,2-diamine |
| SMILES | CC(CN)NC1CCSC1 |
| InChI | InChI=1S/C7H16N2S/c1-6(4-8)9-7-2-3-10-5-7/h6-7,9H,2-5,8H2,1H3 |
| InChIKey | KAYBELRFCSEKLL-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.29 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |