About 5-methoxy-4-(3,3,4-trimethylpiperazin-1-yl)pentan-1-amine
5-methoxy-4-(3,3,4-trimethylpiperazin-1-yl)pentan-1-amine (PubChem CID 103391911) has the molecular formula C13H29N3O
and a molecular weight of 243.39 g/mol. Its IUPAC name is 5-methoxy-4-(3,3,4-trimethylpiperazin-1-yl)pentan-1-amine.
Molecular Properties
| Compound Name | 5-methoxy-4-(3,3,4-trimethylpiperazin-1-yl)pentan-1-amine |
| PubChem CID | 103391911 |
| Molecular Formula | C13H29N3O |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.23 |
| IUPAC Name | 5-methoxy-4-(3,3,4-trimethylpiperazin-1-yl)pentan-1-amine |
| SMILES | COCC(CCCN)N1CCN(C)C(C)(C)C1 |
| InChI | InChI=1S/C13H29N3O/c1-13(2)11-16(9-8-15(13)3)12(10-17-4)6-5-7-14/h12H,5-11,14H2,1-4H3 |
| InChIKey | BMYSKNKOAKMUFA-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methoxy-4-(3,3,4-trimethylpiperazin-1-yl)pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-4-(3,3,4-trimethylpiperazin-1-yl)pentan-1-amine?
The IUPAC name of 5-methoxy-4-(3,3,4-trimethylpiperazin-1-yl)pentan-1-amine (CID 103391911) is 5-methoxy-4-(3,3,4-trimethylpiperazin-1-yl)pentan-1-amine.
What is the SMILES notation for 5-methoxy-4-(3,3,4-trimethylpiperazin-1-yl)pentan-1-amine?
The canonical SMILES for 5-methoxy-4-(3,3,4-trimethylpiperazin-1-yl)pentan-1-amine is COCC(CCCN)N1CCN(C)C(C)(C)C1.
What is the InChIKey of 5-methoxy-4-(3,3,4-trimethylpiperazin-1-yl)pentan-1-amine?
The InChIKey is BMYSKNKOAKMUFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29N3O/c1-13(2)11-16(9-8-15(13)3)12(10-17-4)6-5-7-14/h12H,5-11,14H2,1-4H3.
What are the key properties of 5-methoxy-4-(3,3,4-trimethylpiperazin-1-yl)pentan-1-amine?
5-methoxy-4-(3,3,4-trimethylpiperazin-1-yl)pentan-1-amine has a molecular weight of 243.39 g/mol, XLogP of 0.77, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-4-(3,3,4-trimethylpiperazin-1-yl)pentan-1-amine is sourced from PubChem (CID 103391911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).