About 1-[(2S)-2-(1,3-benzothiazole-2-carbonyl)pyrrolidin-1-yl]-2-(cyclohexylamino)ethanone
1-[(2S)-2-(1,3-benzothiazole-2-carbonyl)pyrrolidin-1-yl]-2-(cyclohexylamino)ethanone (PubChem CID 10339207) has the molecular formula C20H25N3O2S
and a molecular weight of 371.51 g/mol. Its IUPAC name is 1-[(2S)-2-(1,3-benzothiazole-2-carbonyl)pyrrolidin-1-yl]-2-(cyclohexylamino)ethanone.
Molecular Properties
| Compound Name | 1-[(2S)-2-(1,3-benzothiazole-2-carbonyl)pyrrolidin-1-yl]-2-(cyclohexylamino)ethanone |
| PubChem CID | 10339207 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 1-[(2S)-2-(1,3-benzothiazole-2-carbonyl)pyrrolidin-1-yl]-2-(cyclohexylamino)ethanone |
| SMILES | O=C(c1nc2ccccc2s1)[C@@H]1CCCN1C(=O)CNC1CCCCC1 |
| InChI | InChI=1S/C20H25N3O2S/c24-18(13-21-14-7-2-1-3-8-14)23-12-6-10-16(23)19(25)20-22-15-9-4-5-11-17(15)26-20/h4-5,9,11,14,16,21H,1-3,6-8,10,12-13H2/t16-/m0/s1 |
| InChIKey | JUKKLTLYMFFAKS-INIZCTEOSA-N |
| XLogP | 3.39 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(2S)-2-(1,3-benzothiazole-2-carbonyl)pyrrolidin-1-yl]-2-(cyclohexylamino)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S)-2-(1,3-benzothiazole-2-carbonyl)pyrrolidin-1-yl]-2-(cyclohexylamino)ethanone?
The IUPAC name of 1-[(2S)-2-(1,3-benzothiazole-2-carbonyl)pyrrolidin-1-yl]-2-(cyclohexylamino)ethanone (CID 10339207) is 1-[(2S)-2-(1,3-benzothiazole-2-carbonyl)pyrrolidin-1-yl]-2-(cyclohexylamino)ethanone.
What is the SMILES notation for 1-[(2S)-2-(1,3-benzothiazole-2-carbonyl)pyrrolidin-1-yl]-2-(cyclohexylamino)ethanone?
The canonical SMILES for 1-[(2S)-2-(1,3-benzothiazole-2-carbonyl)pyrrolidin-1-yl]-2-(cyclohexylamino)ethanone is O=C(c1nc2ccccc2s1)[C@@H]1CCCN1C(=O)CNC1CCCCC1.
What is the InChIKey of 1-[(2S)-2-(1,3-benzothiazole-2-carbonyl)pyrrolidin-1-yl]-2-(cyclohexylamino)ethanone?
The InChIKey is JUKKLTLYMFFAKS-INIZCTEOSA-N. The full InChI is InChI=1S/C20H25N3O2S/c24-18(13-21-14-7-2-1-3-8-14)23-12-6-10-16(23)19(25)20-22-15-9-4-5-11-17(15)26-20/h4-5,9,11,14,16,21H,1-3,6-8,10,12-13H2/t16-/m0/s1.
What are the key properties of 1-[(2S)-2-(1,3-benzothiazole-2-carbonyl)pyrrolidin-1-yl]-2-(cyclohexylamino)ethanone?
1-[(2S)-2-(1,3-benzothiazole-2-carbonyl)pyrrolidin-1-yl]-2-(cyclohexylamino)ethanone has a molecular weight of 371.51 g/mol, XLogP of 3.39, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S)-2-(1,3-benzothiazole-2-carbonyl)pyrrolidin-1-yl]-2-(cyclohexylamino)ethanone is sourced from PubChem (CID 10339207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).