C11H21NO — CID 103392211
4-(methoxymethyl)-7-methylocta-4,7-dien-1-amine (PubChem CID 103392211) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is 4-(methoxymethyl)-7-methylocta-4,7-dien-1-amine.
| Compound Name | 4-(methoxymethyl)-7-methylocta-4,7-dien-1-amine |
|---|---|
| PubChem CID | 103392211 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 4-(methoxymethyl)-7-methylocta-4,7-dien-1-amine |
| SMILES | C=C(C)CC=C(CCCN)COC |
| InChI | InChI=1S/C11H21NO/c1-10(2)6-7-11(9-13-3)5-4-8-12/h7H,1,4-6,8-9,12H2,2-3H3 |
| InChIKey | KLAZEZMEMUCYMZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|