C12H16F4N2O — CID 103392506
4-fluoro-5-methoxy-4-[4-(trifluoromethyl)-3-pyridinyl]pentan-1-amine (PubChem CID 103392506) has the molecular formula C12H16F4N2O and a molecular weight of 280.26 g/mol. Its IUPAC name is 4-fluoro-5-methoxy-4-[4-(trifluoromethyl)-3-pyridinyl]pentan-1-amine.
| Compound Name | 4-fluoro-5-methoxy-4-[4-(trifluoromethyl)-3-pyridinyl]pentan-1-amine |
|---|---|
| PubChem CID | 103392506 |
| Molecular Formula | C12H16F4N2O |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 4-fluoro-5-methoxy-4-[4-(trifluoromethyl)-3-pyridinyl]pentan-1-amine |
| SMILES | COCC(F)(CCCN)c1cnccc1C(F)(F)F |
| InChI | InChI=1S/C12H16F4N2O/c1-19-8-11(13,4-2-5-17)10-7-18-6-3-9(10)12(14,15)16/h3,6-7H,2,4-5,8,17H2,1H3 |
| InChIKey | QKUMRPBZDCOFCP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |