C15H28FNO2S — CID 103392601
4-fluoro-5-methoxy-4-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)pentan-1-amine (PubChem CID 103392601) has the molecular formula C15H28FNO2S and a molecular weight of 305.46 g/mol. Its IUPAC name is 4-fluoro-5-methoxy-4-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)pentan-1-amine.
| Compound Name | 4-fluoro-5-methoxy-4-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)pentan-1-amine |
|---|---|
| PubChem CID | 103392601 |
| Molecular Formula | C15H28FNO2S |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 4-fluoro-5-methoxy-4-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)pentan-1-amine |
| SMILES | COCC(F)(CCCN)C1CCOC2(CCSCC2)C1 |
| InChI | InChI=1S/C15H28FNO2S/c1-18-12-15(16,4-2-7-17)13-3-8-19-14(11-13)5-9-20-10-6-14/h13H,2-12,17H2,1H3 |
| InChIKey | JNVIUHQRFOTLNH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |