C23H35NO3 — CID 10339327
benzyl (2R,5R)-2-butyl-5-(4-oxoheptyl)pyrrolidine-1-carboxylate (PubChem CID 10339327) has the molecular formula C23H35NO3 and a molecular weight of 373.54 g/mol. Its IUPAC name is benzyl (2R,5R)-2-butyl-5-(4-oxoheptyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R,5R)-2-butyl-5-(4-oxoheptyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10339327 |
| Molecular Formula | C23H35NO3 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | benzyl (2R,5R)-2-butyl-5-(4-oxoheptyl)pyrrolidine-1-carboxylate |
| SMILES | CCCC[C@@H]1CC[C@@H](CCCC(=O)CCC)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H35NO3/c1-3-5-13-20-16-17-21(14-9-15-22(25)10-4-2)24(20)23(26)27-18-19-11-7-6-8-12-19/h6-8,11-12,20-21H,3-5,9-10,13-18H2,1-2H3/t20-,21-/m1/s1 |
| InChIKey | DVELONFSYOTHFB-NHCUHLMSSA-N |
| XLogP | 5.89 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |