C18H21F3O5 — CID 10339360
(Z)-7-[4-(2-hydroxyphenyl)-2-(trifluoromethyl)-1,3-dioxan-5-yl]hept-5-enoic acid (PubChem CID 10339360) has the molecular formula C18H21F3O5 and a molecular weight of 374.36 g/mol. Its IUPAC name is (Z)-7-[4-(2-hydroxyphenyl)-2-(trifluoromethyl)-1,3-dioxan-5-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[4-(2-hydroxyphenyl)-2-(trifluoromethyl)-1,3-dioxan-5-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 10339360 |
| Molecular Formula | C18H21F3O5 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | (Z)-7-[4-(2-hydroxyphenyl)-2-(trifluoromethyl)-1,3-dioxan-5-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\CC1COC(C(F)(F)F)OC1c1ccccc1O |
| InChI | InChI=1S/C18H21F3O5/c19-18(20,21)17-25-11-12(7-3-1-2-4-10-15(23)24)16(26-17)13-8-5-6-9-14(13)22/h1,3,5-6,8-9,12,16-17,22H,2,4,7,10-11H2,(H,23,24)/b3-1- |
| InChIKey | ZWAVGFSZMACJHA-IWQZZHSRSA-N |
| XLogP | 4.19 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|