C21H30N2O4 — CID 10339395
1-[4-[(5-methoxy-3,4-dihydro-2H-chromen-3-yl)amino]butyl]-4,4-dimethylpiperidine-2,6-dione (PubChem CID 10339395) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is 1-[4-[(5-methoxy-3,4-dihydro-2H-chromen-3-yl)amino]butyl]-4,4-dimethylpiperidine-2,6-dione.
| Compound Name | 1-[4-[(5-methoxy-3,4-dihydro-2H-chromen-3-yl)amino]butyl]-4,4-dimethylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 10339395 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 1-[4-[(5-methoxy-3,4-dihydro-2H-chromen-3-yl)amino]butyl]-4,4-dimethylpiperidine-2,6-dione |
| SMILES | COc1cccc2c1CC(NCCCCN1C(=O)CC(C)(C)CC1=O)CO2 |
| InChI | InChI=1S/C21H30N2O4/c1-21(2)12-19(24)23(20(25)13-21)10-5-4-9-22-15-11-16-17(26-3)7-6-8-18(16)27-14-15/h6-8,15,22H,4-5,9-14H2,1-3H3 |
| InChIKey | KQAAENLIAMRMSI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|