C12H17FO2S — CID 103395386
1-(2-fluoro-4-methoxyphenyl)-2-propylsulfanylethanol (PubChem CID 103395386) has the molecular formula C12H17FO2S and a molecular weight of 244.33 g/mol. Its IUPAC name is 1-(2-fluoro-4-methoxyphenyl)-2-propylsulfanylethanol.
| Compound Name | 1-(2-fluoro-4-methoxyphenyl)-2-propylsulfanylethanol |
|---|---|
| PubChem CID | 103395386 |
| Molecular Formula | C12H17FO2S |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 1-(2-fluoro-4-methoxyphenyl)-2-propylsulfanylethanol |
| SMILES | CCCSCC(O)c1ccc(OC)cc1F |
| InChI | InChI=1S/C12H17FO2S/c1-3-6-16-8-12(14)10-5-4-9(15-2)7-11(10)13/h4-5,7,12,14H,3,6,8H2,1-2H3 |
| InChIKey | REMULJLVRQUDRQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|