About 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylpropan-1-amine
2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylpropan-1-amine (PubChem CID 10339539) has the molecular formula C18H17F6NO
and a molecular weight of 377.33 g/mol. Its IUPAC name is 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylpropan-1-amine.
Molecular Properties
| Compound Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylpropan-1-amine |
| PubChem CID | 10339539 |
| Molecular Formula | C18H17F6NO |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylpropan-1-amine |
| SMILES | CC(OCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(N)c1ccccc1 |
| InChI | InChI=1S/C18H17F6NO/c1-11(16(25)13-5-3-2-4-6-13)26-10-12-7-14(17(19,20)21)9-15(8-12)18(22,23)24/h2-9,11,16H,10,25H2,1H3 |
| InChIKey | KCAVUUMWZQIOGX-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylpropan-1-amine?
The IUPAC name of 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylpropan-1-amine (CID 10339539) is 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylpropan-1-amine.
What is the SMILES notation for 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylpropan-1-amine?
The canonical SMILES for 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylpropan-1-amine is CC(OCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(N)c1ccccc1.
What is the InChIKey of 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylpropan-1-amine?
The InChIKey is KCAVUUMWZQIOGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17F6NO/c1-11(16(25)13-5-3-2-4-6-13)26-10-12-7-14(17(19,20)21)9-15(8-12)18(22,23)24/h2-9,11,16H,10,25H2,1H3.
What are the key properties of 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylpropan-1-amine?
2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylpropan-1-amine has a molecular weight of 377.33 g/mol, XLogP of 5.33, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylpropan-1-amine is sourced from PubChem (CID 10339539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).