C21H19N3O4 — CID 10339551
3-[1-(3-hydroxypropyl)pyrrolo[2,3-b]pyridin-3-yl]-4-(2-methoxyphenyl)pyrrole-2,5-dione (PubChem CID 10339551) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is 3-[1-(3-hydroxypropyl)pyrrolo[2,3-b]pyridin-3-yl]-4-(2-methoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3-[1-(3-hydroxypropyl)pyrrolo[2,3-b]pyridin-3-yl]-4-(2-methoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 10339551 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 3-[1-(3-hydroxypropyl)pyrrolo[2,3-b]pyridin-3-yl]-4-(2-methoxyphenyl)pyrrole-2,5-dione |
| SMILES | COc1ccccc1C1=C(c2cn(CCCO)c3ncccc23)C(=O)NC1=O |
| InChI | InChI=1S/C21H19N3O4/c1-28-16-8-3-2-6-14(16)17-18(21(27)23-20(17)26)15-12-24(10-5-11-25)19-13(15)7-4-9-22-19/h2-4,6-9,12,25H,5,10-11H2,1H3,(H,23,26,27) |
| InChIKey | PDZRGSNSFAAGRB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|