C23H22O3S — CID 10339625
[(1R,2S)-1-phenyl-1,2,3,4-tetrahydronaphthalen-2-yl] 4-methylbenzenesulfonate (PubChem CID 10339625) has the molecular formula C23H22O3S and a molecular weight of 378.49 g/mol. Its IUPAC name is [(1R,2S)-1-phenyl-1,2,3,4-tetrahydronaphthalen-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1R,2S)-1-phenyl-1,2,3,4-tetrahydronaphthalen-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10339625 |
| Molecular Formula | C23H22O3S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | [(1R,2S)-1-phenyl-1,2,3,4-tetrahydronaphthalen-2-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2CCc3ccccc3[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C23H22O3S/c1-17-11-14-20(15-12-17)27(24,25)26-22-16-13-18-7-5-6-10-21(18)23(22)19-8-3-2-4-9-19/h2-12,14-15,22-23H,13,16H2,1H3/t22-,23+/m0/s1 |
| InChIKey | UWRLCWRRYVZUEA-XZOQPEGZSA-N |
| XLogP | 4.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|