C15H19F4NO — CID 103397393
(2-fluoro-4-methoxyphenyl)-[3-(trifluoromethyl)cyclohexyl]methanamine (PubChem CID 103397393) has the molecular formula C15H19F4NO and a molecular weight of 305.31 g/mol. Its IUPAC name is (2-fluoro-4-methoxyphenyl)-[3-(trifluoromethyl)cyclohexyl]methanamine.
| Compound Name | (2-fluoro-4-methoxyphenyl)-[3-(trifluoromethyl)cyclohexyl]methanamine |
|---|---|
| PubChem CID | 103397393 |
| Molecular Formula | C15H19F4NO |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (2-fluoro-4-methoxyphenyl)-[3-(trifluoromethyl)cyclohexyl]methanamine |
| SMILES | COc1ccc(C(N)C2CCCC(C(F)(F)F)C2)c(F)c1 |
| InChI | InChI=1S/C15H19F4NO/c1-21-11-5-6-12(13(16)8-11)14(20)9-3-2-4-10(7-9)15(17,18)19/h5-6,8-10,14H,2-4,7,20H2,1H3 |
| InChIKey | DCPRXPRLHCBTPB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |