C16H15FN2OS — CID 103397828
[1-benzothiophen-3-yl-(2-fluoro-4-methoxyphenyl)methyl]hydrazine (PubChem CID 103397828) has the molecular formula C16H15FN2OS and a molecular weight of 302.37 g/mol. Its IUPAC name is [1-benzothiophen-3-yl-(2-fluoro-4-methoxyphenyl)methyl]hydrazine.
| Compound Name | [1-benzothiophen-3-yl-(2-fluoro-4-methoxyphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 103397828 |
| Molecular Formula | C16H15FN2OS |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | [1-benzothiophen-3-yl-(2-fluoro-4-methoxyphenyl)methyl]hydrazine |
| SMILES | COc1ccc(C(NN)c2csc3ccccc23)c(F)c1 |
| InChI | InChI=1S/C16H15FN2OS/c1-20-10-6-7-12(14(17)8-10)16(19-18)13-9-21-15-5-3-2-4-11(13)15/h2-9,16,19H,18H2,1H3 |
| InChIKey | KNCQVQAYGMIKEK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|