C14H12F6N4O2 — CID 10339848
N-(diaminomethylidene)-2-[(1R)-3-oxo-2-(2,2,2-trifluoroethyl)-6-(trifluoromethyl)-1H-isoindol-1-yl]acetamide (PubChem CID 10339848) has the molecular formula C14H12F6N4O2 and a molecular weight of 382.26 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-[(1R)-3-oxo-2-(2,2,2-trifluoroethyl)-6-(trifluoromethyl)-1H-isoindol-1-yl]acetamide.
| Compound Name | N-(diaminomethylidene)-2-[(1R)-3-oxo-2-(2,2,2-trifluoroethyl)-6-(trifluoromethyl)-1H-isoindol-1-yl]acetamide |
|---|---|
| PubChem CID | 10339848 |
| Molecular Formula | C14H12F6N4O2 |
| Molecular Weight | 382.26 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | N-(diaminomethylidene)-2-[(1R)-3-oxo-2-(2,2,2-trifluoroethyl)-6-(trifluoromethyl)-1H-isoindol-1-yl]acetamide |
| SMILES | NC(N)=NC(=O)C[C@@H]1c2cc(C(F)(F)F)ccc2C(=O)N1CC(F)(F)F |
| InChI | InChI=1S/C14H12F6N4O2/c15-13(16,17)5-24-9(4-10(25)23-12(21)22)8-3-6(14(18,19)20)1-2-7(8)11(24)26/h1-3,9H,4-5H2,(H4,21,22,23,25)/t9-/m1/s1 |
| InChIKey | ZQMVRCIHVKTUGS-SECBINFHSA-N |
| XLogP | 1.95 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|