C22H22O6 — CID 10339857
(2E,3E)-2,3-bis[(4-methoxy-3-methylphenyl)methylidene]butanedioic acid (PubChem CID 10339857) has the molecular formula C22H22O6 and a molecular weight of 382.41 g/mol. Its IUPAC name is (2E,3E)-2,3-bis[(4-methoxy-3-methylphenyl)methylidene]butanedioic acid.
| Compound Name | (2E,3E)-2,3-bis[(4-methoxy-3-methylphenyl)methylidene]butanedioic acid |
|---|---|
| PubChem CID | 10339857 |
| Molecular Formula | C22H22O6 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | (2E,3E)-2,3-bis[(4-methoxy-3-methylphenyl)methylidene]butanedioic acid |
| SMILES | COc1ccc(/C=C(C(=O)O)\C(=C/c2ccc(OC)c(C)c2)C(=O)O)cc1C |
| InChI | InChI=1S/C22H22O6/c1-13-9-15(5-7-19(13)27-3)11-17(21(23)24)18(22(25)26)12-16-6-8-20(28-4)14(2)10-16/h5-12H,1-4H3,(H,23,24)(H,25,26)/b17-11+,18-12+ |
| InChIKey | SYXJBQYFPYTXOF-JYFOCSDGSA-N |
| XLogP | 3.96 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|