C15H24N6O6 — CID 10339971
(2S)-5-(diaminomethylideneamino)-2-[4-(2,4-dioxopyrimidin-1-yl)butoxycarbonylamino]pentanoic acid (PubChem CID 10339971) has the molecular formula C15H24N6O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[4-(2,4-dioxopyrimidin-1-yl)butoxycarbonylamino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[4-(2,4-dioxopyrimidin-1-yl)butoxycarbonylamino]pentanoic acid |
|---|---|
| PubChem CID | 10339971 |
| Molecular Formula | C15H24N6O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[4-(2,4-dioxopyrimidin-1-yl)butoxycarbonylamino]pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)OCCCCn1ccc(=O)[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C15H24N6O6/c16-13(17)18-6-3-4-10(12(23)24)19-15(26)27-9-2-1-7-21-8-5-11(22)20-14(21)25/h5,8,10H,1-4,6-7,9H2,(H,19,26)(H,23,24)(H4,16,17,18)(H,20,22,25)/t10-/m0/s1 |
| InChIKey | URNFBTWQHIJSSI-JTQLQIEISA-N |
| XLogP | -1.45 |
| TPSA | 194.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|