C14H16N2O4 — CID 103399766
1-[3-(3,5-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]butan-2-one (PubChem CID 103399766) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 1-[3-(3,5-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]butan-2-one.
| Compound Name | 1-[3-(3,5-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]butan-2-one |
|---|---|
| PubChem CID | 103399766 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 1-[3-(3,5-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]butan-2-one |
| SMILES | CCC(=O)Cc1nc(-c2cc(OC)cc(OC)c2)no1 |
| InChI | InChI=1S/C14H16N2O4/c1-4-10(17)7-13-15-14(16-20-13)9-5-11(18-2)8-12(6-9)19-3/h5-6,8H,4,7H2,1-3H3 |
| InChIKey | UEHBMANIBWMWGA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |