C13H11ClN2O3S — CID 103400235
2-[[(3-chloro-4-methylthiophene-2-carbonyl)amino]methyl]pyridine-4-carboxylic acid (PubChem CID 103400235) has the molecular formula C13H11ClN2O3S and a molecular weight of 310.76 g/mol. Its IUPAC name is 2-[[(3-chloro-4-methylthiophene-2-carbonyl)amino]methyl]pyridine-4-carboxylic acid.
| Compound Name | 2-[[(3-chloro-4-methylthiophene-2-carbonyl)amino]methyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 103400235 |
| Molecular Formula | C13H11ClN2O3S |
| Molecular Weight | 310.76 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 2-[[(3-chloro-4-methylthiophene-2-carbonyl)amino]methyl]pyridine-4-carboxylic acid |
| SMILES | Cc1csc(C(=O)NCc2cc(C(=O)O)ccn2)c1Cl |
| InChI | InChI=1S/C13H11ClN2O3S/c1-7-6-20-11(10(7)14)12(17)16-5-9-4-8(13(18)19)2-3-15-9/h2-4,6H,5H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | ZCTOTERCWXISLD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.76 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |