C11H8ClNO3S — CID 103400367
4-(3-chloro-4-methylthiophene-2-carbonyl)-1H-pyrrole-2-carboxylic acid (PubChem CID 103400367) has the molecular formula C11H8ClNO3S and a molecular weight of 269.71 g/mol. Its IUPAC name is 4-(3-chloro-4-methylthiophene-2-carbonyl)-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-(3-chloro-4-methylthiophene-2-carbonyl)-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 103400367 |
| Molecular Formula | C11H8ClNO3S |
| Molecular Weight | 269.71 g/mol |
| Exact Mass | 268.99 |
| IUPAC Name | 4-(3-chloro-4-methylthiophene-2-carbonyl)-1H-pyrrole-2-carboxylic acid |
| SMILES | Cc1csc(C(=O)c2c[nH]c(C(=O)O)c2)c1Cl |
| InChI | InChI=1S/C11H8ClNO3S/c1-5-4-17-10(8(5)12)9(14)6-2-7(11(15)16)13-3-6/h2-4,13H,1H3,(H,15,16) |
| InChIKey | AVZBSJALWZAEHQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.71 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |