C15H24N2O4 — CID 103400871
4-amino-3-[3-(2-methoxyethoxy)propoxy]-N,N-dimethylbenzamide (PubChem CID 103400871) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is 4-amino-3-[3-(2-methoxyethoxy)propoxy]-N,N-dimethylbenzamide.
| Compound Name | 4-amino-3-[3-(2-methoxyethoxy)propoxy]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 103400871 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 4-amino-3-[3-(2-methoxyethoxy)propoxy]-N,N-dimethylbenzamide |
| SMILES | COCCOCCCOc1cc(C(=O)N(C)C)ccc1N |
| InChI | InChI=1S/C15H24N2O4/c1-17(2)15(18)12-5-6-13(16)14(11-12)21-8-4-7-20-10-9-19-3/h5-6,11H,4,7-10,16H2,1-3H3 |
| InChIKey | WQFWWABFOXNYCX-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|