C14H15BrClNOS — CID 103401408
(3-bromo-4-ethoxyphenyl)-(3-chloro-4-methylthiophen-2-yl)methanamine (PubChem CID 103401408) has the molecular formula C14H15BrClNOS and a molecular weight of 360.70 g/mol. Its IUPAC name is (3-bromo-4-ethoxyphenyl)-(3-chloro-4-methylthiophen-2-yl)methanamine.
| Compound Name | (3-bromo-4-ethoxyphenyl)-(3-chloro-4-methylthiophen-2-yl)methanamine |
|---|---|
| PubChem CID | 103401408 |
| Molecular Formula | C14H15BrClNOS |
| Molecular Weight | 360.70 g/mol |
| Exact Mass | 358.97 |
| IUPAC Name | (3-bromo-4-ethoxyphenyl)-(3-chloro-4-methylthiophen-2-yl)methanamine |
| SMILES | CCOc1ccc(C(N)c2scc(C)c2Cl)cc1Br |
| InChI | InChI=1S/C14H15BrClNOS/c1-3-18-11-5-4-9(6-10(11)15)13(17)14-12(16)8(2)7-19-14/h4-7,13H,3,17H2,1-2H3 |
| InChIKey | NULKMXHNXRMPQP-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.70 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |