About N-[(3-chloro-4-methylthiophen-2-yl)methyl]-N'-propan-2-ylpropane-1,3-diamine
N-[(3-chloro-4-methylthiophen-2-yl)methyl]-N'-propan-2-ylpropane-1,3-diamine (PubChem CID 103401582) has the molecular formula C12H21ClN2S
and a molecular weight of 260.83 g/mol. Its IUPAC name is N-[(3-chloro-4-methylthiophen-2-yl)methyl]-N'-propan-2-ylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N-[(3-chloro-4-methylthiophen-2-yl)methyl]-N'-propan-2-ylpropane-1,3-diamine |
| PubChem CID | 103401582 |
| Molecular Formula | C12H21ClN2S |
| Molecular Weight | 260.83 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N-[(3-chloro-4-methylthiophen-2-yl)methyl]-N'-propan-2-ylpropane-1,3-diamine |
| SMILES | Cc1csc(CNCCCNC(C)C)c1Cl |
| InChI | InChI=1S/C12H21ClN2S/c1-9(2)15-6-4-5-14-7-11-12(13)10(3)8-16-11/h8-9,14-15H,4-7H2,1-3H3 |
| InChIKey | FHSBHXJUUUWSIX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.83 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(3-chloro-4-methylthiophen-2-yl)methyl]-N'-propan-2-ylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-chloro-4-methylthiophen-2-yl)methyl]-N'-propan-2-ylpropane-1,3-diamine?
The IUPAC name of N-[(3-chloro-4-methylthiophen-2-yl)methyl]-N'-propan-2-ylpropane-1,3-diamine (CID 103401582) is N-[(3-chloro-4-methylthiophen-2-yl)methyl]-N'-propan-2-ylpropane-1,3-diamine.
What is the SMILES notation for N-[(3-chloro-4-methylthiophen-2-yl)methyl]-N'-propan-2-ylpropane-1,3-diamine?
The canonical SMILES for N-[(3-chloro-4-methylthiophen-2-yl)methyl]-N'-propan-2-ylpropane-1,3-diamine is Cc1csc(CNCCCNC(C)C)c1Cl.
What is the InChIKey of N-[(3-chloro-4-methylthiophen-2-yl)methyl]-N'-propan-2-ylpropane-1,3-diamine?
The InChIKey is FHSBHXJUUUWSIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21ClN2S/c1-9(2)15-6-4-5-14-7-11-12(13)10(3)8-16-11/h8-9,14-15H,4-7H2,1-3H3.
What are the key properties of N-[(3-chloro-4-methylthiophen-2-yl)methyl]-N'-propan-2-ylpropane-1,3-diamine?
N-[(3-chloro-4-methylthiophen-2-yl)methyl]-N'-propan-2-ylpropane-1,3-diamine has a molecular weight of 260.83 g/mol, XLogP of 3.19, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-chloro-4-methylthiophen-2-yl)methyl]-N'-propan-2-ylpropane-1,3-diamine is sourced from PubChem (CID 103401582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).