C13H8ClFN2OS — CID 103401716
3-chloro-N-(2-cyano-4-fluorophenyl)-4-methylthiophene-2-carboxamide (PubChem CID 103401716) has the molecular formula C13H8ClFN2OS and a molecular weight of 294.74 g/mol. Its IUPAC name is 3-chloro-N-(2-cyano-4-fluorophenyl)-4-methylthiophene-2-carboxamide.
| Compound Name | 3-chloro-N-(2-cyano-4-fluorophenyl)-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103401716 |
| Molecular Formula | C13H8ClFN2OS |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | 3-chloro-N-(2-cyano-4-fluorophenyl)-4-methylthiophene-2-carboxamide |
| SMILES | Cc1csc(C(=O)Nc2ccc(F)cc2C#N)c1Cl |
| InChI | InChI=1S/C13H8ClFN2OS/c1-7-6-19-12(11(7)14)13(18)17-10-3-2-9(15)4-8(10)5-16/h2-4,6H,1H3,(H,17,18) |
| InChIKey | PXSKHFUSRDEERP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |