C11H16ClNO3 — CID 103402231
2-chloro-4-[3-(2-methoxyethoxy)propoxy]pyridine (PubChem CID 103402231) has the molecular formula C11H16ClNO3 and a molecular weight of 245.71 g/mol. Its IUPAC name is 2-chloro-4-[3-(2-methoxyethoxy)propoxy]pyridine.
| Compound Name | 2-chloro-4-[3-(2-methoxyethoxy)propoxy]pyridine |
|---|---|
| PubChem CID | 103402231 |
| Molecular Formula | C11H16ClNO3 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 2-chloro-4-[3-(2-methoxyethoxy)propoxy]pyridine |
| SMILES | COCCOCCCOc1ccnc(Cl)c1 |
| InChI | InChI=1S/C11H16ClNO3/c1-14-7-8-15-5-2-6-16-10-3-4-13-11(12)9-10/h3-4,9H,2,5-8H2,1H3 |
| InChIKey | LTRVCOOHYOQLFE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|