C21H26O5S — CID 10340359
S-phenyl (1R,4S,5R,9S,11R,12R)-1,5,9-trimethyl-10,13,14,15-tetraoxatetracyclo[9.3.1.04,12.08,12]pentadecane-9-carbothioate (PubChem CID 10340359) has the molecular formula C21H26O5S and a molecular weight of 390.50 g/mol. Its IUPAC name is S-phenyl (1R,4S,5R,9S,11R,12R)-1,5,9-trimethyl-10,13,14,15-tetraoxatetracyclo[9.3.1.04,12.08,12]pentadecane-9-carbothioate.
| Compound Name | S-phenyl (1R,4S,5R,9S,11R,12R)-1,5,9-trimethyl-10,13,14,15-tetraoxatetracyclo[9.3.1.04,12.08,12]pentadecane-9-carbothioate |
|---|---|
| PubChem CID | 10340359 |
| Molecular Formula | C21H26O5S |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | S-phenyl (1R,4S,5R,9S,11R,12R)-1,5,9-trimethyl-10,13,14,15-tetraoxatetracyclo[9.3.1.04,12.08,12]pentadecane-9-carbothioate |
| SMILES | C[C@@H]1CCC2[C@]34OO[C@](C)(CC[C@@H]13)O[C@H]4O[C@]2(C)C(=O)Sc1ccccc1 |
| InChI | InChI=1S/C21H26O5S/c1-13-9-10-16-20(3,17(22)27-14-7-5-4-6-8-14)24-18-21(16)15(13)11-12-19(2,23-18)25-26-21/h4-8,13,15-16,18H,9-12H2,1-3H3/t13-,15+,16?,18+,19-,20+,21-/m1/s1 |
| InChIKey | RLMAGUNMIOCDGD-IRXOUXKOSA-N |
| XLogP | 4.31 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|