About S-phenyl (2R,3S)-3-(methoxymethoxy)-3-phenyl-2-trimethylsilyloxypropanethioate
S-phenyl (2R,3S)-3-(methoxymethoxy)-3-phenyl-2-trimethylsilyloxypropanethioate (PubChem CID 10340376) has the molecular formula C20H26O4SSi
and a molecular weight of 390.58 g/mol. Its IUPAC name is S-phenyl (2R,3S)-3-(methoxymethoxy)-3-phenyl-2-trimethylsilyloxypropanethioate.
Molecular Properties
| Compound Name | S-phenyl (2R,3S)-3-(methoxymethoxy)-3-phenyl-2-trimethylsilyloxypropanethioate |
| PubChem CID | 10340376 |
| Molecular Formula | C20H26O4SSi |
| Molecular Weight | 390.58 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | S-phenyl (2R,3S)-3-(methoxymethoxy)-3-phenyl-2-trimethylsilyloxypropanethioate |
| SMILES | COCO[C@@H](c1ccccc1)[C@@H](O[Si](C)(C)C)C(=O)Sc1ccccc1 |
| InChI | InChI=1S/C20H26O4SSi/c1-22-15-23-18(16-11-7-5-8-12-16)19(24-26(2,3)4)20(21)25-17-13-9-6-10-14-17/h5-14,18-19H,15H2,1-4H3/t18-,19+/m0/s1 |
| InChIKey | PQXMPWQCZUKUQG-RBUKOAKNSA-N |
| XLogP | 4.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.58 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-phenyl (2R,3S)-3-(methoxymethoxy)-3-phenyl-2-trimethylsilyloxypropanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-phenyl (2R,3S)-3-(methoxymethoxy)-3-phenyl-2-trimethylsilyloxypropanethioate?
The IUPAC name of S-phenyl (2R,3S)-3-(methoxymethoxy)-3-phenyl-2-trimethylsilyloxypropanethioate (CID 10340376) is S-phenyl (2R,3S)-3-(methoxymethoxy)-3-phenyl-2-trimethylsilyloxypropanethioate.
What is the SMILES notation for S-phenyl (2R,3S)-3-(methoxymethoxy)-3-phenyl-2-trimethylsilyloxypropanethioate?
The canonical SMILES for S-phenyl (2R,3S)-3-(methoxymethoxy)-3-phenyl-2-trimethylsilyloxypropanethioate is COCO[C@@H](c1ccccc1)[C@@H](O[Si](C)(C)C)C(=O)Sc1ccccc1.
What is the InChIKey of S-phenyl (2R,3S)-3-(methoxymethoxy)-3-phenyl-2-trimethylsilyloxypropanethioate?
The InChIKey is PQXMPWQCZUKUQG-RBUKOAKNSA-N. The full InChI is InChI=1S/C20H26O4SSi/c1-22-15-23-18(16-11-7-5-8-12-16)19(24-26(2,3)4)20(21)25-17-13-9-6-10-14-17/h5-14,18-19H,15H2,1-4H3/t18-,19+/m0/s1.
What are the key properties of S-phenyl (2R,3S)-3-(methoxymethoxy)-3-phenyl-2-trimethylsilyloxypropanethioate?
S-phenyl (2R,3S)-3-(methoxymethoxy)-3-phenyl-2-trimethylsilyloxypropanethioate has a molecular weight of 390.58 g/mol, XLogP of 4.89, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-phenyl (2R,3S)-3-(methoxymethoxy)-3-phenyl-2-trimethylsilyloxypropanethioate is sourced from PubChem (CID 10340376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).