C11H13ClOS — CID 103404383
(3-chloro-4-methylthiophen-2-yl)-(cyclopenten-1-yl)methanol (PubChem CID 103404383) has the molecular formula C11H13ClOS and a molecular weight of 228.74 g/mol. Its IUPAC name is (3-chloro-4-methylthiophen-2-yl)-(cyclopenten-1-yl)methanol.
| Compound Name | (3-chloro-4-methylthiophen-2-yl)-(cyclopenten-1-yl)methanol |
|---|---|
| PubChem CID | 103404383 |
| Molecular Formula | C11H13ClOS |
| Molecular Weight | 228.74 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | (3-chloro-4-methylthiophen-2-yl)-(cyclopenten-1-yl)methanol |
| SMILES | Cc1csc(C(O)C2=CCCC2)c1Cl |
| InChI | InChI=1S/C11H13ClOS/c1-7-6-14-11(9(7)12)10(13)8-4-2-3-5-8/h4,6,10,13H,2-3,5H2,1H3 |
| InChIKey | OHRDANFOTGPYGA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.74 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|