C16H24N2O3 — CID 103404528
3-[3-(2-methoxyethoxy)propoxy]-2-(methylamino)-2-phenylpropanenitrile (PubChem CID 103404528) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 3-[3-(2-methoxyethoxy)propoxy]-2-(methylamino)-2-phenylpropanenitrile.
| Compound Name | 3-[3-(2-methoxyethoxy)propoxy]-2-(methylamino)-2-phenylpropanenitrile |
|---|---|
| PubChem CID | 103404528 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 3-[3-(2-methoxyethoxy)propoxy]-2-(methylamino)-2-phenylpropanenitrile |
| SMILES | CNC(C#N)(COCCCOCCOC)c1ccccc1 |
| InChI | InChI=1S/C16H24N2O3/c1-18-16(13-17,15-7-4-3-5-8-15)14-21-10-6-9-20-12-11-19-2/h3-5,7-8,18H,6,9-12,14H2,1-2H3 |
| InChIKey | ZEXPPPKKCYKUAV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 63.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|