C18H20N2O8 — CID 10340455
4-[(2S,3R)-4-(4,5-dihydroxy-2-nitrophenyl)-2,3-dimethylbutyl]-5-nitrobenzene-1,2-diol (PubChem CID 10340455) has the molecular formula C18H20N2O8 and a molecular weight of 392.36 g/mol. Its IUPAC name is 4-[(2S,3R)-4-(4,5-dihydroxy-2-nitrophenyl)-2,3-dimethylbutyl]-5-nitrobenzene-1,2-diol.
| Compound Name | 4-[(2S,3R)-4-(4,5-dihydroxy-2-nitrophenyl)-2,3-dimethylbutyl]-5-nitrobenzene-1,2-diol |
|---|---|
| PubChem CID | 10340455 |
| Molecular Formula | C18H20N2O8 |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 4-[(2S,3R)-4-(4,5-dihydroxy-2-nitrophenyl)-2,3-dimethylbutyl]-5-nitrobenzene-1,2-diol |
| SMILES | C[C@H](Cc1cc(O)c(O)cc1[N+](=O)[O-])[C@@H](C)Cc1cc(O)c(O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H20N2O8/c1-9(3-11-5-15(21)17(23)7-13(11)19(25)26)10(2)4-12-6-16(22)18(24)8-14(12)20(27)28/h5-10,21-24H,3-4H2,1-2H3/t9-,10+ |
| InChIKey | FYRRTSVQMATNSC-AOOOYVTPSA-N |
| XLogP | 3.38 |
| TPSA | 167.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|