C15H23IO4 — CID 103405052
1-[2-iodo-1-[3-(2-methoxyethoxy)propoxy]ethyl]-3-methoxybenzene (PubChem CID 103405052) has the molecular formula C15H23IO4 and a molecular weight of 394.25 g/mol. Its IUPAC name is 1-[2-iodo-1-[3-(2-methoxyethoxy)propoxy]ethyl]-3-methoxybenzene.
| Compound Name | 1-[2-iodo-1-[3-(2-methoxyethoxy)propoxy]ethyl]-3-methoxybenzene |
|---|---|
| PubChem CID | 103405052 |
| Molecular Formula | C15H23IO4 |
| Molecular Weight | 394.25 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 1-[2-iodo-1-[3-(2-methoxyethoxy)propoxy]ethyl]-3-methoxybenzene |
| SMILES | COCCOCCCOC(CI)c1cccc(OC)c1 |
| InChI | InChI=1S/C15H23IO4/c1-17-9-10-19-7-4-8-20-15(12-16)13-5-3-6-14(11-13)18-2/h3,5-6,11,15H,4,7-10,12H2,1-2H3 |
| InChIKey | RLGSYKWGSOXTSJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.25 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|