C13H11ClF3NS — CID 103405830
(3-chloro-4-methylthiophen-2-yl)-[3-(trifluoromethyl)phenyl]methanamine (PubChem CID 103405830) has the molecular formula C13H11ClF3NS and a molecular weight of 305.75 g/mol. Its IUPAC name is (3-chloro-4-methylthiophen-2-yl)-[3-(trifluoromethyl)phenyl]methanamine.
| Compound Name | (3-chloro-4-methylthiophen-2-yl)-[3-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 103405830 |
| Molecular Formula | C13H11ClF3NS |
| Molecular Weight | 305.75 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | (3-chloro-4-methylthiophen-2-yl)-[3-(trifluoromethyl)phenyl]methanamine |
| SMILES | Cc1csc(C(N)c2cccc(C(F)(F)F)c2)c1Cl |
| InChI | InChI=1S/C13H11ClF3NS/c1-7-6-19-12(10(7)14)11(18)8-3-2-4-9(5-8)13(15,16)17/h2-6,11H,18H2,1H3 |
| InChIKey | IKLOSIXQSBZDJK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.75 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |