C15H22ClN3S — CID 103406335
1-(3-chloro-4-methylthiophen-2-yl)-2-(1-pentan-3-ylpyrazol-3-yl)ethanamine (PubChem CID 103406335) has the molecular formula C15H22ClN3S and a molecular weight of 311.88 g/mol. Its IUPAC name is 1-(3-chloro-4-methylthiophen-2-yl)-2-(1-pentan-3-ylpyrazol-3-yl)ethanamine.
| Compound Name | 1-(3-chloro-4-methylthiophen-2-yl)-2-(1-pentan-3-ylpyrazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 103406335 |
| Molecular Formula | C15H22ClN3S |
| Molecular Weight | 311.88 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 1-(3-chloro-4-methylthiophen-2-yl)-2-(1-pentan-3-ylpyrazol-3-yl)ethanamine |
| SMILES | CCC(CC)n1ccc(CC(N)c2scc(C)c2Cl)n1 |
| InChI | InChI=1S/C15H22ClN3S/c1-4-12(5-2)19-7-6-11(18-19)8-13(17)15-14(16)10(3)9-20-15/h6-7,9,12-13H,4-5,8,17H2,1-3H3 |
| InChIKey | QMEGAAVIHZLHRC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.88 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |