C11H10BrClOS2 — CID 103407934
2-(4-bromothiophen-2-yl)-1-(3-chloro-4-methylthiophen-2-yl)ethanol (PubChem CID 103407934) has the molecular formula C11H10BrClOS2 and a molecular weight of 337.69 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-1-(3-chloro-4-methylthiophen-2-yl)ethanol.
| Compound Name | 2-(4-bromothiophen-2-yl)-1-(3-chloro-4-methylthiophen-2-yl)ethanol |
|---|---|
| PubChem CID | 103407934 |
| Molecular Formula | C11H10BrClOS2 |
| Molecular Weight | 337.69 g/mol |
| Exact Mass | 335.90 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-1-(3-chloro-4-methylthiophen-2-yl)ethanol |
| SMILES | Cc1csc(C(O)Cc2cc(Br)cs2)c1Cl |
| InChI | InChI=1S/C11H10BrClOS2/c1-6-4-16-11(10(6)13)9(14)3-8-2-7(12)5-15-8/h2,4-5,9,14H,3H2,1H3 |
| InChIKey | JCRJVAAQSPXRLM-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.69 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |