C12H20N4O5 — CID 103408213
N-ethyl-6-[3-(2-methoxyethoxy)propoxy]-5-nitropyrimidin-4-amine (PubChem CID 103408213) has the molecular formula C12H20N4O5 and a molecular weight of 300.31 g/mol. Its IUPAC name is N-ethyl-6-[3-(2-methoxyethoxy)propoxy]-5-nitropyrimidin-4-amine.
| Compound Name | N-ethyl-6-[3-(2-methoxyethoxy)propoxy]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 103408213 |
| Molecular Formula | C12H20N4O5 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | N-ethyl-6-[3-(2-methoxyethoxy)propoxy]-5-nitropyrimidin-4-amine |
| SMILES | CCNc1ncnc(OCCCOCCOC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H20N4O5/c1-3-13-11-10(16(17)18)12(15-9-14-11)21-6-4-5-20-8-7-19-2/h9H,3-8H2,1-2H3,(H,13,14,15) |
| InChIKey | BENSWSKLNSKSJN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|