C14H15ClN2O2S — CID 103408542
[(3-chloro-4-methylthiophen-2-yl)-(2,3-dihydro-1,4-benzodioxin-6-yl)methyl]hydrazine (PubChem CID 103408542) has the molecular formula C14H15ClN2O2S and a molecular weight of 310.81 g/mol. Its IUPAC name is [(3-chloro-4-methylthiophen-2-yl)-(2,3-dihydro-1,4-benzodioxin-6-yl)methyl]hydrazine.
| Compound Name | [(3-chloro-4-methylthiophen-2-yl)-(2,3-dihydro-1,4-benzodioxin-6-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 103408542 |
| Molecular Formula | C14H15ClN2O2S |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | [(3-chloro-4-methylthiophen-2-yl)-(2,3-dihydro-1,4-benzodioxin-6-yl)methyl]hydrazine |
| SMILES | Cc1csc(C(NN)c2ccc3c(c2)OCCO3)c1Cl |
| InChI | InChI=1S/C14H15ClN2O2S/c1-8-7-20-14(12(8)15)13(17-16)9-2-3-10-11(6-9)19-5-4-18-10/h2-3,6-7,13,17H,4-5,16H2,1H3 |
| InChIKey | MZGRMEQMUURTAN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|