C17H10F9N — CID 10340860
N-[2,5-bis(trifluoromethyl)phenyl]-1-[4-(trifluoromethyl)phenyl]ethanimine (PubChem CID 10340860) has the molecular formula C17H10F9N and a molecular weight of 399.26 g/mol. Its IUPAC name is N-[2,5-bis(trifluoromethyl)phenyl]-1-[4-(trifluoromethyl)phenyl]ethanimine.
| Compound Name | N-[2,5-bis(trifluoromethyl)phenyl]-1-[4-(trifluoromethyl)phenyl]ethanimine |
|---|---|
| PubChem CID | 10340860 |
| Molecular Formula | C17H10F9N |
| Molecular Weight | 399.26 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | N-[2,5-bis(trifluoromethyl)phenyl]-1-[4-(trifluoromethyl)phenyl]ethanimine |
| SMILES | C/C(=N\c1cc(C(F)(F)F)ccc1C(F)(F)F)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H10F9N/c1-9(10-2-4-11(5-3-10)15(18,19)20)27-14-8-12(16(21,22)23)6-7-13(14)17(24,25)26/h2-8H,1H3/b27-9+ |
| InChIKey | BAENCEWHEVSMQL-OXUBWTJQSA-N |
| XLogP | 6.88 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.26 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|