About 3-(4-benzylpiperazin-1-yl)-1-hydroxy-1,1-diphenylpropan-2-one
3-(4-benzylpiperazin-1-yl)-1-hydroxy-1,1-diphenylpropan-2-one (PubChem CID 10340952) has the molecular formula C26H28N2O2
and a molecular weight of 400.52 g/mol. Its IUPAC name is 3-(4-benzylpiperazin-1-yl)-1-hydroxy-1,1-diphenylpropan-2-one.
Molecular Properties
| Compound Name | 3-(4-benzylpiperazin-1-yl)-1-hydroxy-1,1-diphenylpropan-2-one |
| PubChem CID | 10340952 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 3-(4-benzylpiperazin-1-yl)-1-hydroxy-1,1-diphenylpropan-2-one |
| SMILES | O=C(CN1CCN(Cc2ccccc2)CC1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H28N2O2/c29-25(21-28-18-16-27(17-19-28)20-22-10-4-1-5-11-22)26(30,23-12-6-2-7-13-23)24-14-8-3-9-15-24/h1-15,30H,16-21H2 |
| InChIKey | JUJMBIUXWHJEQS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4-benzylpiperazin-1-yl)-1-hydroxy-1,1-diphenylpropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-benzylpiperazin-1-yl)-1-hydroxy-1,1-diphenylpropan-2-one?
The IUPAC name of 3-(4-benzylpiperazin-1-yl)-1-hydroxy-1,1-diphenylpropan-2-one (CID 10340952) is 3-(4-benzylpiperazin-1-yl)-1-hydroxy-1,1-diphenylpropan-2-one.
What is the SMILES notation for 3-(4-benzylpiperazin-1-yl)-1-hydroxy-1,1-diphenylpropan-2-one?
The canonical SMILES for 3-(4-benzylpiperazin-1-yl)-1-hydroxy-1,1-diphenylpropan-2-one is O=C(CN1CCN(Cc2ccccc2)CC1)C(O)(c1ccccc1)c1ccccc1.
What is the InChIKey of 3-(4-benzylpiperazin-1-yl)-1-hydroxy-1,1-diphenylpropan-2-one?
The InChIKey is JUJMBIUXWHJEQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H28N2O2/c29-25(21-28-18-16-27(17-19-28)20-22-10-4-1-5-11-22)26(30,23-12-6-2-7-13-23)24-14-8-3-9-15-24/h1-15,30H,16-21H2.
What are the key properties of 3-(4-benzylpiperazin-1-yl)-1-hydroxy-1,1-diphenylpropan-2-one?
3-(4-benzylpiperazin-1-yl)-1-hydroxy-1,1-diphenylpropan-2-one has a molecular weight of 400.52 g/mol, XLogP of 3.31, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-benzylpiperazin-1-yl)-1-hydroxy-1,1-diphenylpropan-2-one is sourced from PubChem (CID 10340952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).