About 4-(benzylsulfanylmethyl)-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline
4-(benzylsulfanylmethyl)-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline (PubChem CID 10341012) has the molecular formula C26H27NOS
and a molecular weight of 401.58 g/mol. Its IUPAC name is 4-(benzylsulfanylmethyl)-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline.
Molecular Properties
| Compound Name | 4-(benzylsulfanylmethyl)-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline |
| PubChem CID | 10341012 |
| Molecular Formula | C26H27NOS |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 4-(benzylsulfanylmethyl)-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline |
| SMILES | COc1ccccc1-c1ccc2c(c1)C(CSCc1ccccc1)=CC(C)(C)N2 |
| InChI | InChI=1S/C26H27NOS/c1-26(2)16-21(18-29-17-19-9-5-4-6-10-19)23-15-20(13-14-24(23)27-26)22-11-7-8-12-25(22)28-3/h4-16,27H,17-18H2,1-3H3 |
| InChIKey | MMEYJCDBDLRVJV-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(benzylsulfanylmethyl)-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(benzylsulfanylmethyl)-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline?
The IUPAC name of 4-(benzylsulfanylmethyl)-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline (CID 10341012) is 4-(benzylsulfanylmethyl)-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline.
What is the SMILES notation for 4-(benzylsulfanylmethyl)-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline?
The canonical SMILES for 4-(benzylsulfanylmethyl)-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline is COc1ccccc1-c1ccc2c(c1)C(CSCc1ccccc1)=CC(C)(C)N2.
What is the InChIKey of 4-(benzylsulfanylmethyl)-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline?
The InChIKey is MMEYJCDBDLRVJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27NOS/c1-26(2)16-21(18-29-17-19-9-5-4-6-10-19)23-15-20(13-14-24(23)27-26)22-11-7-8-12-25(22)28-3/h4-16,27H,17-18H2,1-3H3.
What are the key properties of 4-(benzylsulfanylmethyl)-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline?
4-(benzylsulfanylmethyl)-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline has a molecular weight of 401.58 g/mol, XLogP of 6.88, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(benzylsulfanylmethyl)-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline is sourced from PubChem (CID 10341012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).