C18H27IO2 — CID 10341031
(1R,2R,3R,4R,11S)-4-[(Z,2S)-1-hydroxy-5-iodohex-4-en-2-yl]-11-methyltricyclo[5.4.0.02,11]undec-7-en-3-ol (PubChem CID 10341031) has the molecular formula C18H27IO2 and a molecular weight of 402.32 g/mol. Its IUPAC name is (1R,2R,3R,4R,11S)-4-[(Z,2S)-1-hydroxy-5-iodohex-4-en-2-yl]-11-methyltricyclo[5.4.0.02,11]undec-7-en-3-ol.
| Compound Name | (1R,2R,3R,4R,11S)-4-[(Z,2S)-1-hydroxy-5-iodohex-4-en-2-yl]-11-methyltricyclo[5.4.0.02,11]undec-7-en-3-ol |
|---|---|
| PubChem CID | 10341031 |
| Molecular Formula | C18H27IO2 |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | (1R,2R,3R,4R,11S)-4-[(Z,2S)-1-hydroxy-5-iodohex-4-en-2-yl]-11-methyltricyclo[5.4.0.02,11]undec-7-en-3-ol |
| SMILES | C/C(I)=C/C[C@H](CO)[C@H]1CCC2=CCC[C@]3(C)[C@H]([C@@H]1O)[C@H]23 |
| InChI | InChI=1S/C18H27IO2/c1-11(19)5-6-13(10-20)14-8-7-12-4-3-9-18(2)15(12)16(18)17(14)21/h4-5,13-17,20-21H,3,6-10H2,1-2H3/b11-5-/t13-,14-,15+,16+,17-,18+/m1/s1 |
| InChIKey | OOWHEZHBUIUECZ-GKPNUFHPSA-N |
| XLogP | 4.07 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|