C11H17NO4 — CID 103410362
1-[3-(2-methoxyethoxy)propyl]pyrrole-3-carboxylic acid (PubChem CID 103410362) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is 1-[3-(2-methoxyethoxy)propyl]pyrrole-3-carboxylic acid.
| Compound Name | 1-[3-(2-methoxyethoxy)propyl]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 103410362 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 1-[3-(2-methoxyethoxy)propyl]pyrrole-3-carboxylic acid |
| SMILES | COCCOCCCn1ccc(C(=O)O)c1 |
| InChI | InChI=1S/C11H17NO4/c1-15-7-8-16-6-2-4-12-5-3-10(9-12)11(13)14/h3,5,9H,2,4,6-8H2,1H3,(H,13,14) |
| InChIKey | VLSCRFFPXUYJOM-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|