C25H38O4 — CID 10341078
(1S,3R,6S,7R,9E,13S,15R,16S)-6,15-dihydroxy-3,15-dimethyl-6-[(2S)-6-methylhept-5-en-2-yl]-12-oxatetracyclo[8.5.1.03,7.013,16]hexadec-9-en-11-one (PubChem CID 10341078) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is (1S,3R,6S,7R,9E,13S,15R,16S)-6,15-dihydroxy-3,15-dimethyl-6-[(2S)-6-methylhept-5-en-2-yl]-12-oxatetracyclo[8.5.1.03,7.013,16]hexadec-9-en-11-one.
| Compound Name | (1S,3R,6S,7R,9E,13S,15R,16S)-6,15-dihydroxy-3,15-dimethyl-6-[(2S)-6-methylhept-5-en-2-yl]-12-oxatetracyclo[8.5.1.03,7.013,16]hexadec-9-en-11-one |
|---|---|
| PubChem CID | 10341078 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | (1S,3R,6S,7R,9E,13S,15R,16S)-6,15-dihydroxy-3,15-dimethyl-6-[(2S)-6-methylhept-5-en-2-yl]-12-oxatetracyclo[8.5.1.03,7.013,16]hexadec-9-en-11-one |
| SMILES | CC(C)=CCC[C@H](C)[C@@]1(O)CC[C@]2(C)C[C@H]3[C@H]4/C(=C\C[C@H]21)C(=O)O[C@H]4C[C@@]3(C)O |
| InChI | InChI=1S/C25H38O4/c1-15(2)7-6-8-16(3)25(28)12-11-23(4)13-18-21-17(9-10-20(23)25)22(26)29-19(21)14-24(18,5)27/h7,9,16,18-21,27-28H,6,8,10-14H2,1-5H3/b17-9+/t16-,18-,19-,20+,21+,23+,24+,25-/m0/s1 |
| InChIKey | QQIDJUCXUQXXFU-MIOWFVLLSA-N |
| XLogP | 4.55 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|