C21H26O4SSi — CID 10341081
(2R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolane-5-carboxylic acid (PubChem CID 10341081) has the molecular formula C21H26O4SSi and a molecular weight of 402.59 g/mol. Its IUPAC name is (2R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolane-5-carboxylic acid.
| Compound Name | (2R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolane-5-carboxylic acid |
|---|---|
| PubChem CID | 10341081 |
| Molecular Formula | C21H26O4SSi |
| Molecular Weight | 402.59 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | (2R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolane-5-carboxylic acid |
| SMILES | CC(C)(C)[Si](OC[C@@H]1O[C@H](C(=O)O)CS1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H26O4SSi/c1-21(2,3)27(16-10-6-4-7-11-16,17-12-8-5-9-13-17)24-14-19-25-18(15-26-19)20(22)23/h4-13,18-19H,14-15H2,1-3H3,(H,22,23)/t18-,19+/m0/s1 |
| InChIKey | VOUUQIHVWRWOIY-RBUKOAKNSA-N |
| XLogP | 3.11 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.59 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|