ethyl 3,5-dibromo-4-(4-methoxyphenyl)-1H-pyrrole-2-carboxylate

C14H13Br2NO3 — CID 10341096

IUPACethyl 3,5-dibromo-4-(4-methoxyphenyl)-1H-pyrrole-2-carboxylate
SMILESCCOC(=O)c1[nH]c(Br)c(-c2ccc(OC)cc2)c1Br
InChIInChI=1S/C14H13Br2NO3/c1-3-20-14(18)12-11(15)10(13(16)17-12)8-4-6-9(19-2)7-5-8/h4-7,17H,3H2,1-2H3
InChIKeyHXXFXLQAPQTLOP-UHFFFAOYSA-N
MW403.07 g/mol
LogP4.39
Rot. Bonds4

About ethyl 3,5-dibromo-4-(4-methoxyphenyl)-1H-pyrrole-2-carboxylate

ethyl 3,5-dibromo-4-(4-methoxyphenyl)-1H-pyrrole-2-carboxylate (PubChem CID 10341096) has the molecular formula C14H13Br2NO3 and a molecular weight of 403.07 g/mol. Its IUPAC name is ethyl 3,5-dibromo-4-(4-methoxyphenyl)-1H-pyrrole-2-carboxylate.

Molecular Properties

Compound Nameethyl 3,5-dibromo-4-(4-methoxyphenyl)-1H-pyrrole-2-carboxylate
PubChem CID10341096
Molecular FormulaC14H13Br2NO3
Molecular Weight403.07 g/mol
Exact Mass400.93
IUPAC Nameethyl 3,5-dibromo-4-(4-methoxyphenyl)-1H-pyrrole-2-carboxylate
SMILESCCOC(=O)c1[nH]c(Br)c(-c2ccc(OC)cc2)c1Br
InChIInChI=1S/C14H13Br2NO3/c1-3-20-14(18)12-11(15)10(13(16)17-12)8-4-6-9(19-2)7-5-8/h4-7,17H,3H2,1-2H3
InChIKeyHXXFXLQAPQTLOP-UHFFFAOYSA-N
XLogP4.39
TPSA51.32 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500403.07
LogP ≤ 54.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze ethyl 3,5-dibromo-4-(4-methoxyphenyl)-1H-pyrrole-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 3,5-dibromo-4-(4-methoxyphenyl)-1H-pyrrole-2-carboxylate?
The IUPAC name of ethyl 3,5-dibromo-4-(4-methoxyphenyl)-1H-pyrrole-2-carboxylate (CID 10341096) is ethyl 3,5-dibromo-4-(4-methoxyphenyl)-1H-pyrrole-2-carboxylate.
What is the SMILES notation for ethyl 3,5-dibromo-4-(4-methoxyphenyl)-1H-pyrrole-2-carboxylate?
The canonical SMILES for ethyl 3,5-dibromo-4-(4-methoxyphenyl)-1H-pyrrole-2-carboxylate is CCOC(=O)c1[nH]c(Br)c(-c2ccc(OC)cc2)c1Br.
What is the InChIKey of ethyl 3,5-dibromo-4-(4-methoxyphenyl)-1H-pyrrole-2-carboxylate?
The InChIKey is HXXFXLQAPQTLOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13Br2NO3/c1-3-20-14(18)12-11(15)10(13(16)17-12)8-4-6-9(19-2)7-5-8/h4-7,17H,3H2,1-2H3.
What are the key properties of ethyl 3,5-dibromo-4-(4-methoxyphenyl)-1H-pyrrole-2-carboxylate?
ethyl 3,5-dibromo-4-(4-methoxyphenyl)-1H-pyrrole-2-carboxylate has a molecular weight of 403.07 g/mol, XLogP of 4.39, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3,5-dibromo-4-(4-methoxyphenyl)-1H-pyrrole-2-carboxylate is sourced from PubChem (CID 10341096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).