C16H23ClN2O2 — CID 103411335
1-[6-chloro-1-[3-(2-methoxyethoxy)propyl]indol-3-yl]-N-methylmethanamine (PubChem CID 103411335) has the molecular formula C16H23ClN2O2 and a molecular weight of 310.83 g/mol. Its IUPAC name is 1-[6-chloro-1-[3-(2-methoxyethoxy)propyl]indol-3-yl]-N-methylmethanamine.
| Compound Name | 1-[6-chloro-1-[3-(2-methoxyethoxy)propyl]indol-3-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 103411335 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 1-[6-chloro-1-[3-(2-methoxyethoxy)propyl]indol-3-yl]-N-methylmethanamine |
| SMILES | CNCc1cn(CCCOCCOC)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C16H23ClN2O2/c1-18-11-13-12-19(6-3-7-21-9-8-20-2)16-10-14(17)4-5-15(13)16/h4-5,10,12,18H,3,6-9,11H2,1-2H3 |
| InChIKey | UAJCDCKMYVZBEC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 35.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|