C26H29NO3 — CID 10341135
7-[(4,6-diphenyl-2-pyridinyl)oxy]-2,2-dimethylheptanoic acid (PubChem CID 10341135) has the molecular formula C26H29NO3 and a molecular weight of 403.52 g/mol. Its IUPAC name is 7-[(4,6-diphenyl-2-pyridinyl)oxy]-2,2-dimethylheptanoic acid.
| Compound Name | 7-[(4,6-diphenyl-2-pyridinyl)oxy]-2,2-dimethylheptanoic acid |
|---|---|
| PubChem CID | 10341135 |
| Molecular Formula | C26H29NO3 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 7-[(4,6-diphenyl-2-pyridinyl)oxy]-2,2-dimethylheptanoic acid |
| SMILES | CC(C)(CCCCCOc1cc(-c2ccccc2)cc(-c2ccccc2)n1)C(=O)O |
| InChI | InChI=1S/C26H29NO3/c1-26(2,25(28)29)16-10-5-11-17-30-24-19-22(20-12-6-3-7-13-20)18-23(27-24)21-14-8-4-9-15-21/h3-4,6-9,12-15,18-19H,5,10-11,16-17H2,1-2H3,(H,28,29) |
| InChIKey | LLOIWCULINVBNX-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|